About CID 136741777
CID 136741777 (PubChem CID 136741777) has the molecular formula C24H45Si5
and a molecular weight of 474.05 g/mol.
Molecular Properties
| Compound Name | CID 136741777 |
| PubChem CID | 136741777 |
| Molecular Formula | C24H45Si5 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | — |
| SMILES | C#CC1=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C1C#C[Si](CC)(CC)[Si](CC)CC |
| InChI | InChI=1S/C24H45Si5/c1-14-21-22(19-20-29(17-4,18-5)25(15-2)16-3)24(27(9,10)11)28(12,13)23(21)26(6,7)8/h1H,15-18H2,2-13H3 |
| InChIKey | SIUFWTMIHPAHGI-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 136741777 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136741777?
The IUPAC name of CID 136741777 (CID 136741777) is not available.
What is the SMILES notation for CID 136741777?
The canonical SMILES for CID 136741777 is C#CC1=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C1C#C[Si](CC)(CC)[Si](CC)CC.
What is the InChIKey of CID 136741777?
The InChIKey is SIUFWTMIHPAHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H45Si5/c1-14-21-22(19-20-29(17-4,18-5)25(15-2)16-3)24(27(9,10)11)28(12,13)23(21)26(6,7)8/h1H,15-18H2,2-13H3.
What are the key properties of CID 136741777?
CID 136741777 has a molecular weight of 474.05 g/mol, XLogP of 7.41, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136741777 is sourced from PubChem (CID 136741777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).