C48H34N4O4 — CID 136742195
methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136742195) has the molecular formula C48H34N4O4 and a molecular weight of 730.82 g/mol. Its IUPAC name is methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136742195 |
| Molecular Formula | C48H34N4O4 |
| Molecular Weight | 730.82 g/mol |
| Exact Mass | 730.26 |
| IUPAC Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H34N4O4/c1-55-47(53)33-17-13-31(14-18-33)45-39-25-21-35(49-39)43(29-9-5-3-6-10-29)37-23-27-41(51-37)46(32-15-19-34(20-16-32)48(54)56-2)42-28-24-38(52-42)44(30-11-7-4-8-12-30)36-22-26-40(45)50-36/h3-28,49,52H,1-2H3/b43-35-,43-37-,44-36-,44-38-,45-39-,45-40-,46-41-,46-42- |
| InChIKey | PCBSSHXGDJTMIQ-IWLVSUONSA-N |
| XLogP | 10.90 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.82 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |