C14H22N4O2 — CID 136742758
4-(2,8-diazaspiro[5.5]undecan-2-yl)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136742758) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(2,8-diazaspiro[5.5]undecan-2-yl)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(2,8-diazaspiro[5.5]undecan-2-yl)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136742758 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-(2,8-diazaspiro[5.5]undecan-2-yl)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N2CCCC3(CCCNC3)C2)nc[nH]c1=O |
| InChI | InChI=1S/C14H22N4O2/c1-20-11-12(16-10-17-13(11)19)18-7-3-5-14(9-18)4-2-6-15-8-14/h10,15H,2-9H2,1H3,(H,16,17,19) |
| InChIKey | ZSTXNJMMMXSPPT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |