C25H25NO — CID 136743185
2-[(1S,8R,9S)-8-benzyl-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenol (PubChem CID 136743185) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-benzyl-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenol.
| Compound Name | 2-[(1S,8R,9S)-8-benzyl-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenol |
|---|---|
| PubChem CID | 136743185 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[(1S,8R,9S)-8-benzyl-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenol |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@@H](Cc1ccccc1)c1nc(-c3ccccc3O)ccc12 |
| InChI | InChI=1S/C25H25NO/c1-25(2)20-15-21(25)19(14-16-8-4-3-5-9-16)24-17(20)12-13-22(26-24)18-10-6-7-11-23(18)27/h3-13,19-21,27H,14-15H2,1-2H3/t19-,20-,21+/m1/s1 |
| InChIKey | WMDYNTIJZREELT-NJYVYQBISA-N |
| XLogP | 5.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |