C27H28N2O7 — CID 136743546
(4S,7S)-7-(4-hydroxy-3-methoxyphenyl)-3-methyl-4-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one (PubChem CID 136743546) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is (4S,7S)-7-(4-hydroxy-3-methoxyphenyl)-3-methyl-4-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S,7S)-7-(4-hydroxy-3-methoxyphenyl)-3-methyl-4-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136743546 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (4S,7S)-7-(4-hydroxy-3-methoxyphenyl)-3-methyl-4-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one |
| SMILES | COc1cc([C@@H]2CC(=O)C3=C(C2)Nc2onc(C)c2[C@@H]3c2cc(OC)c(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C27H28N2O7/c1-13-23-24(16-11-21(33-3)26(35-5)22(12-16)34-4)25-17(28-27(23)36-29-13)8-15(9-19(25)31)14-6-7-18(30)20(10-14)32-2/h6-7,10-12,15,24,28,30H,8-9H2,1-5H3/t15-,24-/m0/s1 |
| InChIKey | OFMVWKUXRVOWOF-OWJWWREXSA-N |
| XLogP | 4.68 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |