C16H16N2O5 — CID 136743699
2-[2-[(4-acetylphenoxy)methyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136743699) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-[2-[(4-acetylphenoxy)methyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(4-acetylphenoxy)methyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136743699 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[2-[(4-acetylphenoxy)methyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | CC(=O)c1ccc(OCc2nc(C)c(CC(=O)O)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H16N2O5/c1-9-13(7-15(20)21)16(22)18-14(17-9)8-23-12-5-3-11(4-6-12)10(2)19/h3-6H,7-8H2,1-2H3,(H,20,21)(H,17,18,22) |
| InChIKey | VKJFLKKGSPNBDC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |