C25H23N5O3S — CID 136743728
N-[2-hydroxy-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]indol-3-yl]iminothiophene-2-carboxamide (PubChem CID 136743728) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is N-[2-hydroxy-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]indol-3-yl]iminothiophene-2-carboxamide.
| Compound Name | N-[2-hydroxy-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]indol-3-yl]iminothiophene-2-carboxamide |
|---|---|
| PubChem CID | 136743728 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-[2-hydroxy-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]indol-3-yl]iminothiophene-2-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2C[C@@H]3C[C@H](C2)c2cccc(=O)n2C3)c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C25H23N5O3S/c31-22-9-3-7-19-17-11-16(13-29(19)22)12-28(14-17)15-30-20-6-2-1-5-18(20)23(25(30)33)26-27-24(32)21-8-4-10-34-21/h1-10,16-17,33H,11-15H2/b27-26+/t16-,17+/m0/s1 |
| InChIKey | RXTRKOCBXVKNFX-YYXBSBLPSA-N |
| XLogP | 4.57 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|