About 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one
2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (PubChem CID 136743938) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| PubChem CID | 136743938 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCO)nc2c1COC2 |
| InChI | InChI=1S/C8H10N2O3/c11-2-1-7-9-6-4-13-3-5(6)8(12)10-7/h11H,1-4H2,(H,9,10,12) |
| InChIKey | LHBGFWLVMQUDCG-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (CID 136743938) is 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is O=c1[nH]c(CCO)nc2c1COC2.
What is the InChIKey of 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The InChIKey is LHBGFWLVMQUDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c11-2-1-7-9-6-4-13-3-5(6)8(12)10-7/h11H,1-4H2,(H,9,10,12).
What are the key properties of 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one has a molecular weight of 182.18 g/mol, XLogP of -0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 136743938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).