C27H29N3O3 — CID 136744346
3-[2-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] (PubChem CID 136744346) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane].
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 136744346 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)C2CCC(C2)C12CC(C1=Nc3ccccc3NC(c3ccc4c(c3)OCO4)C1)=NO2 |
| InChI | InChI=1S/C27H29N3O3/c1-26(2)17-8-9-18(12-17)27(26)14-23(30-33-27)22-13-21(28-19-5-3-4-6-20(19)29-22)16-7-10-24-25(11-16)32-15-31-24/h3-7,10-11,17-18,21,28H,8-9,12-15H2,1-2H3 |
| InChIKey | PPTJTAMQDLWLBC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |