C22H24N4O5S — CID 136745490
(5R)-5-(4-hydroxy-3-nitrophenyl)-8,8-dimethyl-2-propan-2-ylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136745490) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is (5R)-5-(4-hydroxy-3-nitrophenyl)-8,8-dimethyl-2-propan-2-ylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-5-(4-hydroxy-3-nitrophenyl)-8,8-dimethyl-2-propan-2-ylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136745490 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (5R)-5-(4-hydroxy-3-nitrophenyl)-8,8-dimethyl-2-propan-2-ylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC(C)Sc1nc2c(c(=O)[nH]1)[C@H](c1ccc(O)c([N+](=O)[O-])c1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C22H24N4O5S/c1-10(2)32-21-24-19-18(20(29)25-21)16(11-5-6-14(27)13(7-11)26(30)31)17-12(23-19)8-22(3,4)9-15(17)28/h5-7,10,16,27H,8-9H2,1-4H3,(H2,23,24,25,29)/t16-/m1/s1 |
| InChIKey | LUFFATYZEHCUEV-MRXNPFEDSA-N |
| XLogP | 4.08 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|