C6H11N3O2 — CID 136745813
3-(2-ethoxyethyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136745813) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(2-ethoxyethyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136745813 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-(2-ethoxyethyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CCOCCc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H11N3O2/c1-2-11-4-3-5-7-6(10)9-8-5/h2-4H2,1H3,(H2,7,8,9,10) |
| InChIKey | RYIBTZAFTJJAMD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|