C26H24N2O5 — CID 136746406
methyl 4-[(4S,7S)-7-(4-methoxyphenyl)-3-methyl-5-oxo-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-4-yl]benzoate (PubChem CID 136746406) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is methyl 4-[(4S,7S)-7-(4-methoxyphenyl)-3-methyl-5-oxo-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(4S,7S)-7-(4-methoxyphenyl)-3-methyl-5-oxo-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 136746406 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | methyl 4-[(4S,7S)-7-(4-methoxyphenyl)-3-methyl-5-oxo-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C3=C(C[C@H](c4ccc(OC)cc4)CC3=O)Nc3onc(C)c32)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-14-22-23(16-4-6-17(7-5-16)26(30)32-3)24-20(27-25(22)33-28-14)12-18(13-21(24)29)15-8-10-19(31-2)11-9-15/h4-11,18,23,27H,12-13H2,1-3H3/t18-,23-/m0/s1 |
| InChIKey | JGMPWZVKYWJRFY-MBSDFSHPSA-N |
| XLogP | 4.74 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |