C16H19N3S — CID 136747074
3-[(1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile (PubChem CID 136747074) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 3-[(1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile.
| Compound Name | 3-[(1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 136747074 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[(1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(C/N=C2/NC3CCCCC3CS2)c1 |
| InChI | InChI=1S/C16H19N3S/c17-9-12-4-3-5-13(8-12)10-18-16-19-15-7-2-1-6-14(15)11-20-16/h3-5,8,14-15H,1-2,6-7,10-11H2,(H,18,19) |
| InChIKey | LSZJVSCTKSPIBZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|