C15H27N3S — CID 136747265
1-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]-N,N-dimethylcyclopentan-1-amine (PubChem CID 136747265) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 1-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]-N,N-dimethylcyclopentan-1-amine.
| Compound Name | 1-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]-N,N-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 136747265 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]-N,N-dimethylcyclopentan-1-amine |
| SMILES | CN(C)C1(C/N=C2/NC3CCCC3CS2)CCCC1 |
| InChI | InChI=1S/C15H27N3S/c1-18(2)15(8-3-4-9-15)11-16-14-17-13-7-5-6-12(13)10-19-14/h12-13H,3-11H2,1-2H3,(H,16,17) |
| InChIKey | HEJFAKJARGMSBE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|