C16H23N3 — CID 136747586
N-tert-butylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-imine (PubChem CID 136747586) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-tert-butylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-imine.
| Compound Name | N-tert-butylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-imine |
|---|---|
| PubChem CID | 136747586 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-tert-butylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-imine |
| SMILES | CC(C)(C)/N=C1\Nc2ccccc2NC12CCCC2 |
| InChI | InChI=1S/C16H23N3/c1-15(2,3)19-14-16(10-6-7-11-16)18-13-9-5-4-8-12(13)17-14/h4-5,8-9,18H,6-7,10-11H2,1-3H3,(H,17,19) |
| InChIKey | CMWTYEAQKRMYHS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|