C29H27BrF3N5OS — CID 136748146
(4-benzhydrylpiperazin-1-yl)-[(5R,7R)-3-bromo-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 136748146) has the molecular formula C29H27BrF3N5OS and a molecular weight of 630.53 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[(5R,7R)-3-bromo-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[(5R,7R)-3-bromo-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 136748146 |
| Molecular Formula | C29H27BrF3N5OS |
| Molecular Weight | 630.53 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[(5R,7R)-3-bromo-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1nn2c(c1Br)N[C@@H](c1cccs1)C[C@@H]2C(F)(F)F)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H27BrF3N5OS/c30-24-25(35-38-23(29(31,32)33)18-21(34-27(24)38)22-12-7-17-40-22)28(39)37-15-13-36(14-16-37)26(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-12,17,21,23,26,34H,13-16,18H2/t21-,23-/m1/s1 |
| InChIKey | XEFXRWJRZCATNN-FYYLOGMGSA-N |
| XLogP | 6.91 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |