C23H20N2O9 — CID 136748346
dimethyl 3-[4-hydroxy-2,3-bis(methoxycarbonyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 136748346) has the molecular formula C23H20N2O9 and a molecular weight of 468.42 g/mol. Its IUPAC name is dimethyl 3-[4-hydroxy-2,3-bis(methoxycarbonyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-hydroxy-2,3-bis(methoxycarbonyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 136748346 |
| Molecular Formula | C23H20N2O9 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | dimethyl 3-[4-hydroxy-2,3-bis(methoxycarbonyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(O)ccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C23H20N2O9/c1-31-20(27)15-13(10-11-14(26)16(15)21(28)32-2)18-17(22(29)33-3)19(23(30)34-4)25(24-18)12-8-6-5-7-9-12/h5-11,26H,1-4H3 |
| InChIKey | KIZSZCNFUWLAHX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|