About ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate
ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate (PubChem CID 136750083) has the molecular formula C10H10Cl2N2O3
and a molecular weight of 277.11 g/mol. Its IUPAC name is ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate |
| PubChem CID | 136750083 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H10Cl2N2O3/c1-2-17-10(16)14-13-5-6-3-7(11)4-8(12)9(6)15/h3-5,15H,2H2,1H3,(H,14,16)/b13-5- |
| InChIKey | MVKVCPOZAMQBKR-ACAGNQJTSA-N |
| XLogP | 2.78 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate?
The IUPAC name of ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate (CID 136750083) is ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate.
What is the SMILES notation for ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate?
The canonical SMILES for ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate is CCOC(=O)N/N=C\c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate?
The InChIKey is MVKVCPOZAMQBKR-ACAGNQJTSA-N. The full InChI is InChI=1S/C10H10Cl2N2O3/c1-2-17-10(16)14-13-5-6-3-7(11)4-8(12)9(6)15/h3-5,15H,2H2,1H3,(H,14,16)/b13-5-.
What are the key properties of ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate?
ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate has a molecular weight of 277.11 g/mol, XLogP of 2.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamate is sourced from PubChem (CID 136750083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).