C15H10BrFN2O2 — CID 136751174
4-[3-(3-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol (PubChem CID 136751174) has the molecular formula C15H10BrFN2O2 and a molecular weight of 349.16 g/mol. Its IUPAC name is 4-[3-(3-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol.
| Compound Name | 4-[3-(3-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
|---|---|
| PubChem CID | 136751174 |
| Molecular Formula | C15H10BrFN2O2 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 4-[3-(3-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
| SMILES | Cc1cc(-c2nc(-c3cc(F)cc(Br)c3)no2)ccc1O |
| InChI | InChI=1S/C15H10BrFN2O2/c1-8-4-9(2-3-13(8)20)15-18-14(19-21-15)10-5-11(16)7-12(17)6-10/h2-7,20H,1H3 |
| InChIKey | OSGBZJVPVZFEQG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |