C15H20N2O3 — CID 136751308
4-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methylphenol (PubChem CID 136751308) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methylphenol.
| Compound Name | 4-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
|---|---|
| PubChem CID | 136751308 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
| SMILES | CCOC(C)(CC)c1noc(-c2ccc(O)c(C)c2)n1 |
| InChI | InChI=1S/C15H20N2O3/c1-5-15(4,19-6-2)14-16-13(20-17-14)11-7-8-12(18)10(3)9-11/h7-9,18H,5-6H2,1-4H3 |
| InChIKey | HDISDWPJIMBXOJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |