About 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol
4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol (PubChem CID 136751543) has the molecular formula C8H6FN3OS
and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol.
Molecular Properties
| Compound Name | 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol |
| PubChem CID | 136751543 |
| Molecular Formula | C8H6FN3OS |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol |
| SMILES | Nc1nnc(-c2ccc(O)cc2F)s1 |
| InChI | InChI=1S/C8H6FN3OS/c9-6-3-4(13)1-2-5(6)7-11-12-8(10)14-7/h1-3,13H,(H2,10,12) |
| InChIKey | QVHZGSQAOXEUKV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol?
The IUPAC name of 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol (CID 136751543) is 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol.
What is the SMILES notation for 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol?
The canonical SMILES for 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol is Nc1nnc(-c2ccc(O)cc2F)s1.
What is the InChIKey of 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol?
The InChIKey is QVHZGSQAOXEUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3OS/c9-6-3-4(13)1-2-5(6)7-11-12-8(10)14-7/h1-3,13H,(H2,10,12).
What are the key properties of 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol?
4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol has a molecular weight of 211.22 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1,3,4-thiadiazol-2-yl)-3-fluorophenol is sourced from PubChem (CID 136751543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).