C11H8FN5O2 — CID 136751601
2-amino-8-(2-fluoro-4-hydroxyphenyl)-1,7-dihydropurin-6-one (PubChem CID 136751601) has the molecular formula C11H8FN5O2 and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-amino-8-(2-fluoro-4-hydroxyphenyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(2-fluoro-4-hydroxyphenyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136751601 |
| Molecular Formula | C11H8FN5O2 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-amino-8-(2-fluoro-4-hydroxyphenyl)-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(-c3ccc(O)cc3F)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H8FN5O2/c12-6-3-4(18)1-2-5(6)8-14-7-9(15-8)16-11(13)17-10(7)19/h1-3,18H,(H4,13,14,15,16,17,19) |
| InChIKey | IPORVSXYJLJEBG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |