C24H24FN3O4S — CID 136752044
(5R)-2-[(2-fluorophenyl)methylsulfanyl]-5-(3-methoxy-2-propoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136752044) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is (5R)-2-[(2-fluorophenyl)methylsulfanyl]-5-(3-methoxy-2-propoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5R)-2-[(2-fluorophenyl)methylsulfanyl]-5-(3-methoxy-2-propoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136752044 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (5R)-2-[(2-fluorophenyl)methylsulfanyl]-5-(3-methoxy-2-propoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCOc1c(OC)cccc1[C@H]1CC(=O)Nc2nc(SCc3ccccc3F)[nH]c(=O)c21 |
| InChI | InChI=1S/C24H24FN3O4S/c1-3-11-32-21-15(8-6-10-18(21)31-2)16-12-19(29)26-22-20(16)23(30)28-24(27-22)33-13-14-7-4-5-9-17(14)25/h4-10,16H,3,11-13H2,1-2H3,(H2,26,27,28,29,30)/t16-/m1/s1 |
| InChIKey | LLDCLYCLFVLYPR-MRXNPFEDSA-N |
| XLogP | 4.47 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |