C21H21F3N2O2 — CID 136752991
7-[(3,5-dimethylpiperidin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol (PubChem CID 136752991) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 7-[(3,5-dimethylpiperidin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol.
| Compound Name | 7-[(3,5-dimethylpiperidin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 136752991 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 7-[(3,5-dimethylpiperidin-1-yl)methyl]-3-(3,4,5-trifluorophenyl)-1,2-benzoxazol-6-ol |
| SMILES | CC1CC(C)CN(Cc2c(O)ccc3c(-c4cc(F)c(F)c(F)c4)noc23)C1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-11-5-12(2)9-26(8-11)10-15-18(27)4-3-14-20(25-28-21(14)15)13-6-16(22)19(24)17(23)7-13/h3-4,6-7,11-12,27H,5,8-10H2,1-2H3 |
| InChIKey | SVHMJAXSTJWTLK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|