C21H26N2O4 — CID 136753121
2-[N-[2-[1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]-4-methoxyphenol (PubChem CID 136753121) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[N-[2-[1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]-4-methoxyphenol.
| Compound Name | 2-[N-[2-[1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 136753121 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[N-[2-[1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(/C(C)=N/CC(C)/N=C(\C)c2cc(OC)ccc2O)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-13(23-15(3)19-11-17(27-5)7-9-21(19)25)12-22-14(2)18-10-16(26-4)6-8-20(18)24/h6-11,13,24-25H,12H2,1-5H3/b22-14+,23-15+ |
| InChIKey | ZHYVTGIDNRTSCW-HOFJZWJUSA-N |
| XLogP | 3.82 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|