About CID 136753167
CID 136753167 (PubChem CID 136753167) has the molecular formula C11H21BN2
and a molecular weight of 192.11 g/mol.
Molecular Properties
| Compound Name | CID 136753167 |
| PubChem CID | 136753167 |
| Molecular Formula | C11H21BN2 |
| Molecular Weight | 192.11 g/mol |
| Exact Mass | 192.18 |
| IUPAC Name | — |
| SMILES | [B]C1N(C(C)C)C(C)=C(C)N1C(C)C |
| InChI | InChI=1S/C11H21BN2/c1-7(2)13-9(5)10(6)14(8(3)4)11(13)12/h7-8,11H,1-6H3 |
| InChIKey | JWMOKPVGGFJISN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.11 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136753167 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136753167?
The IUPAC name of CID 136753167 (CID 136753167) is not available.
What is the SMILES notation for CID 136753167?
The canonical SMILES for CID 136753167 is [B]C1N(C(C)C)C(C)=C(C)N1C(C)C.
What is the InChIKey of CID 136753167?
The InChIKey is JWMOKPVGGFJISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21BN2/c1-7(2)13-9(5)10(6)14(8(3)4)11(13)12/h7-8,11H,1-6H3.
What are the key properties of CID 136753167?
CID 136753167 has a molecular weight of 192.11 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136753167 is sourced from PubChem (CID 136753167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).