C22H19N3O3 — CID 136753592
2-[(5R,10bR)-5-pyridin-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol (PubChem CID 136753592) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[(5R,10bR)-5-pyridin-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol.
| Compound Name | 2-[(5R,10bR)-5-pyridin-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol |
|---|---|
| PubChem CID | 136753592 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-[(5R,10bR)-5-pyridin-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C2=NN3[C@H](C2)c2ccccc2O[C@@H]3c2cccnc2)c1 |
| InChI | InChI=1S/C22H19N3O3/c1-27-15-8-9-20(26)17(11-15)18-12-19-16-6-2-3-7-21(16)28-22(25(19)24-18)14-5-4-10-23-13-14/h2-11,13,19,22,26H,12H2,1H3/t19-,22-/m1/s1 |
| InChIKey | IXSGDXIXBOMYNT-DENIHFKCSA-N |
| XLogP | 4.04 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|