C23H22ClN5O — CID 136753756
(9R)-9-(2-chlorophenyl)-2-[4-(dimethylamino)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136753756) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is (9R)-9-(2-chlorophenyl)-2-[4-(dimethylamino)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(2-chlorophenyl)-2-[4-(dimethylamino)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136753756 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (9R)-9-(2-chlorophenyl)-2-[4-(dimethylamino)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CN(C)c1ccc(-c2nc3n(n2)[C@@H](c2ccccc2Cl)C2=C(CCCC2=O)N3)cc1 |
| InChI | InChI=1S/C23H22ClN5O/c1-28(2)15-12-10-14(11-13-15)22-26-23-25-18-8-5-9-19(30)20(18)21(29(23)27-22)16-6-3-4-7-17(16)24/h3-4,6-7,10-13,21H,5,8-9H2,1-2H3,(H,25,26,27)/t21-/m0/s1 |
| InChIKey | DREWULQQSAZEHY-NRFANRHFSA-N |
| XLogP | 4.69 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |