C12H19N3O2 — CID 136754603
2-methyl-4-[2-(oxan-2-yl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136754603) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-methyl-4-[2-(oxan-2-yl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[2-(oxan-2-yl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136754603 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-methyl-4-[2-(oxan-2-yl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCCC2CCCCO2)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H19N3O2/c1-9-14-11(8-12(16)15-9)13-6-5-10-4-2-3-7-17-10/h8,10H,2-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | PGEKWVIWIMAFQH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |