C14H25N3O2S — CID 136755271
ethyl 4-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]piperidine-1-carboxylate (PubChem CID 136755271) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is ethyl 4-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136755271 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | ethyl 4-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(/N=C2/NC(C)CC(C)S2)CC1 |
| InChI | InChI=1S/C14H25N3O2S/c1-4-19-14(18)17-7-5-12(6-8-17)16-13-15-10(2)9-11(3)20-13/h10-12H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | DTWZUEBSJPUVGB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|