C22H23N5O4S — CID 136755725
N-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 136755725) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 136755725 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H23N5O4S/c28-21(26-25-14-17-13-23-20-6-2-1-5-19(17)20)15-24-22(29)16-7-9-18(10-8-16)32(30,31)27-11-3-4-12-27/h1-2,5-10,13-14,23H,3-4,11-12,15H2,(H,24,29)(H,26,28)/b25-14- |
| InChIKey | RCVGOGLSUXDSMT-QFEZKATASA-N |
| XLogP | 1.83 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|