C17H20N4O3 — CID 136756310
(2S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 136756310) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 136756310 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(NCCNC(=O)[C@@H]2CCc3ccccc3O2)n1 |
| InChI | InChI=1S/C17H20N4O3/c1-11-10-15(22)21-17(20-11)19-9-8-18-16(23)14-7-6-12-4-2-3-5-13(12)24-14/h2-5,10,14H,6-9H2,1H3,(H,18,23)(H2,19,20,21,22)/t14-/m0/s1 |
| InChIKey | QDVFBVDLCBRASH-AWEZNQCLSA-N |
| XLogP | 1.00 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|