C15H20N4O2 — CID 136756516
5-(1H-imidazol-2-yl)-7-(methoxymethoxy)-1-methyl-3,4-diazatricyclo[5.2.2.02,6]undeca-2(6),4-diene (PubChem CID 136756516) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-(1H-imidazol-2-yl)-7-(methoxymethoxy)-1-methyl-3,4-diazatricyclo[5.2.2.02,6]undeca-2(6),4-diene.
| Compound Name | 5-(1H-imidazol-2-yl)-7-(methoxymethoxy)-1-methyl-3,4-diazatricyclo[5.2.2.02,6]undeca-2(6),4-diene |
|---|---|
| PubChem CID | 136756516 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-(1H-imidazol-2-yl)-7-(methoxymethoxy)-1-methyl-3,4-diazatricyclo[5.2.2.02,6]undeca-2(6),4-diene |
| SMILES | COCOC12CCC(C)(CC1)c1[nH]nc(-c3ncc[nH]3)c12 |
| InChI | InChI=1S/C15H20N4O2/c1-14-3-5-15(6-4-14,21-9-20-2)10-11(18-19-12(10)14)13-16-7-8-17-13/h7-8H,3-6,9H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | GNMZJIMJGUWOFC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|