About 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol
1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol (PubChem CID 136756610) has the molecular formula C30H30N2O2
and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol |
| PubChem CID | 136756610 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol |
| SMILES | COc1ccc(/N=C/c2c(O)c(-c3ccccc3)c(-c3ccccc3)n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H30N2O2/c1-34-26-19-17-24(18-20-26)31-21-27-30(33)28(22-11-5-2-6-12-22)29(23-13-7-3-8-14-23)32(27)25-15-9-4-10-16-25/h2-3,5-8,11-14,17-21,25,33H,4,9-10,15-16H2,1H3/b31-21+ |
| InChIKey | OWQUXFCGHLFEQB-NJZRLIGZSA-N |
| XLogP | 7.79 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol?
The IUPAC name of 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol (CID 136756610) is 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol.
What is the SMILES notation for 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol?
The canonical SMILES for 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol is COc1ccc(/N=C/c2c(O)c(-c3ccccc3)c(-c3ccccc3)n2C2CCCCC2)cc1.
What is the InChIKey of 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol?
The InChIKey is OWQUXFCGHLFEQB-NJZRLIGZSA-N. The full InChI is InChI=1S/C30H30N2O2/c1-34-26-19-17-24(18-20-26)31-21-27-30(33)28(22-11-5-2-6-12-22)29(23-13-7-3-8-14-23)32(27)25-15-9-4-10-16-25/h2-3,5-8,11-14,17-21,25,33H,4,9-10,15-16H2,1H3/b31-21+.
What are the key properties of 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol?
1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol has a molecular weight of 450.58 g/mol, XLogP of 7.79, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-[(4-methoxyphenyl)iminomethyl]-4,5-diphenylpyrrol-3-ol is sourced from PubChem (CID 136756610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).