About methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate
methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate (PubChem CID 136757113) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate |
| PubChem CID | 136757113 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate |
| SMILES | CCC1(C)CCS/C(=N\C(C)C(=O)OC)N1 |
| InChI | InChI=1S/C11H20N2O2S/c1-5-11(3)6-7-16-10(13-11)12-8(2)9(14)15-4/h8H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | GYRKHSOBUHVCRN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate?
The IUPAC name of methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate (CID 136757113) is methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate.
What is the SMILES notation for methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate?
The canonical SMILES for methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate is CCC1(C)CCS/C(=N\C(C)C(=O)OC)N1.
What is the InChIKey of methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate?
The InChIKey is GYRKHSOBUHVCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2S/c1-5-11(3)6-7-16-10(13-11)12-8(2)9(14)15-4/h8H,5-7H2,1-4H3,(H,12,13).
What are the key properties of methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate?
methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate has a molecular weight of 244.36 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propanoate is sourced from PubChem (CID 136757113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).