C14H25N3S — CID 136757143
4-ethyl-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazinan-2-imine (PubChem CID 136757143) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is 4-ethyl-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136757143 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-ethyl-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazinan-2-imine |
| SMILES | CCC1(C)CCS/C(=N\C2CCN3CCCC23)N1 |
| InChI | InChI=1S/C14H25N3S/c1-3-14(2)7-10-18-13(16-14)15-11-6-9-17-8-4-5-12(11)17/h11-12H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | PWRQNKIADINFDP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|