C12H15N3O — CID 136758052
2-[4-[2-(methylamino)ethyl]-1H-pyrazol-5-yl]phenol (PubChem CID 136758052) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[4-[2-(methylamino)ethyl]-1H-pyrazol-5-yl]phenol.
| Compound Name | 2-[4-[2-(methylamino)ethyl]-1H-pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 136758052 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-[4-[2-(methylamino)ethyl]-1H-pyrazol-5-yl]phenol |
| SMILES | CNCCc1cn[nH]c1-c1ccccc1O |
| InChI | InChI=1S/C12H15N3O/c1-13-7-6-9-8-14-15-12(9)10-4-2-3-5-11(10)16/h2-5,8,13,16H,6-7H2,1H3,(H,14,15) |
| InChIKey | NCMJJUACQUXKAT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |