C9H15N3O2 — CID 136759219
4-(5-hydroxypentylamino)-1H-pyrimidin-6-one (PubChem CID 136759219) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(5-hydroxypentylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(5-hydroxypentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136759219 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-(5-hydroxypentylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCCCCCO)nc[nH]1 |
| InChI | InChI=1S/C9H15N3O2/c13-5-3-1-2-4-10-8-6-9(14)12-7-11-8/h6-7,13H,1-5H2,(H2,10,11,12,14) |
| InChIKey | FDGUJNPDGUSMBA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|