C5H10N4 — CID 136760137
(2Z,4E)-3,5-diaminopenta-2,4-dienimidamide (PubChem CID 136760137) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is (2Z,4E)-3,5-diaminopenta-2,4-dienimidamide.
| Compound Name | (2Z,4E)-3,5-diaminopenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 136760137 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | (2Z,4E)-3,5-diaminopenta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C=C(N)/C=C/N |
| InChI | InChI=1S/C5H10N4/c6-2-1-4(7)3-5(8)9/h1-3H,6-7H2,(H3,8,9)/b2-1+,4-3- |
| InChIKey | VLKUBEYBSILLJE-XLFBNKDWSA-N |
| XLogP | -0.76 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|