About 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one
4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136760400) has the molecular formula C17H18FN3O2
and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one |
| PubChem CID | 136760400 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | CC(=O)N1C[C@H](c2cc(=O)[nH]c(C)n2)[C@@H](c2ccccc2F)C1 |
| InChI | InChI=1S/C17H18FN3O2/c1-10-19-16(7-17(23)20-10)14-9-21(11(2)22)8-13(14)12-5-3-4-6-15(12)18/h3-7,13-14H,8-9H2,1-2H3,(H,19,20,23)/t13-,14+/m1/s1 |
| InChIKey | HCOHJYCQYLAXSK-KGLIPLIRSA-N |
| XLogP | 1.95 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one?
The IUPAC name of 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one (CID 136760400) is 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one is CC(=O)N1C[C@H](c2cc(=O)[nH]c(C)n2)[C@@H](c2ccccc2F)C1.
What is the InChIKey of 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one?
The InChIKey is HCOHJYCQYLAXSK-KGLIPLIRSA-N. The full InChI is InChI=1S/C17H18FN3O2/c1-10-19-16(7-17(23)20-10)14-9-21(11(2)22)8-13(14)12-5-3-4-6-15(12)18/h3-7,13-14H,8-9H2,1-2H3,(H,19,20,23)/t13-,14+/m1/s1.
What are the key properties of 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one?
4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one has a molecular weight of 315.35 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,4S)-1-acetyl-4-(2-fluorophenyl)pyrrolidin-3-yl]-2-methyl-1H-pyrimidin-6-one is sourced from PubChem (CID 136760400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).