C20H27F3N4O3 — CID 136760599
5,5-dimethyl-4-[4-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]oxolan-2-one (PubChem CID 136760599) has the molecular formula C20H27F3N4O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is 5,5-dimethyl-4-[4-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]oxolan-2-one.
| Compound Name | 5,5-dimethyl-4-[4-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]oxolan-2-one |
|---|---|
| PubChem CID | 136760599 |
| Molecular Formula | C20H27F3N4O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5,5-dimethyl-4-[4-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]oxolan-2-one |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](C1CCN(C(=O)C3CC(=O)OC3(C)C)CC1)N2 |
| InChI | InChI=1S/C20H27F3N4O3/c1-11-8-16-24-14(10-15(20(21,22)23)27(16)25-11)12-4-6-26(7-5-12)18(29)13-9-17(28)30-19(13,2)3/h8,12-15,24H,4-7,9-10H2,1-3H3/t13?,14-,15+/m0/s1 |
| InChIKey | OHWDRYFWUUMBBB-NOYMGPGASA-N |
| XLogP | 3.06 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |