C19H29F3N4O2 — CID 136760691
1-[4-[(5S,7R)-2-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 136760691) has the molecular formula C19H29F3N4O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-2-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 136760691 |
| Molecular Formula | C19H29F3N4O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC([C@@H]2C[C@H](C(F)(F)F)n3nc(C(C)(C)C)cc3N2)CC1 |
| InChI | InChI=1S/C19H29F3N4O2/c1-18(2,3)14-10-16-23-13(9-15(19(20,21)22)26(16)24-14)12-5-7-25(8-6-12)17(27)11-28-4/h10,12-13,15,23H,5-9,11H2,1-4H3/t13-,15+/m0/s1 |
| InChIKey | NZYXTRZYVFUXAK-DZGCQCFKSA-N |
| XLogP | 3.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |