C15H24F3N5O2S — CID 136761296
N,N-dimethyl-4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-sulfonamide (PubChem CID 136761296) has the molecular formula C15H24F3N5O2S and a molecular weight of 395.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 136761296 |
| Molecular Formula | C15H24F3N5O2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N,N-dimethyl-4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-sulfonamide |
| SMILES | C[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCN(S(=O)(=O)N(C)C)CC3)cc2N1 |
| InChI | InChI=1S/C15H24F3N5O2S/c1-10-8-13(15(16,17)18)23-14(19-10)9-12(20-23)11-4-6-22(7-5-11)26(24,25)21(2)3/h9-11,13,19H,4-8H2,1-3H3/t10-,13-/m1/s1 |
| InChIKey | LCAIBLFHIQYNBH-ZWNOBZJWSA-N |
| XLogP | 2.18 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |