C18H27F3N4O — CID 136761302
2,2-dimethyl-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 136761302) has the molecular formula C18H27F3N4O and a molecular weight of 372.44 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 136761302 |
| Molecular Formula | C18H27F3N4O |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2,2-dimethyl-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | C[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCN(C(=O)C(C)(C)C)CC3)cc2N1 |
| InChI | InChI=1S/C18H27F3N4O/c1-11-9-14(18(19,20)21)25-15(22-11)10-13(23-25)12-5-7-24(8-6-12)16(26)17(2,3)4/h10-12,14,22H,5-9H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | OELQRJDSOJWCFI-BXUZGUMPSA-N |
| XLogP | 3.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |