C16H23F3N4O2 — CID 136761303
2-methoxy-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]ethanone (PubChem CID 136761303) has the molecular formula C16H23F3N4O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-methoxy-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 136761303 |
| Molecular Formula | C16H23F3N4O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-methoxy-1-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCC(c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](C)N3)CC1 |
| InChI | InChI=1S/C16H23F3N4O2/c1-10-7-13(16(17,18)19)23-14(20-10)8-12(21-23)11-3-5-22(6-4-11)15(24)9-25-2/h8,10-11,13,20H,3-7,9H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | KQDZQBJLXLPVQY-ZWNOBZJWSA-N |
| XLogP | 2.54 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |