C19H17F3N6O2 — CID 136761500
6-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 136761500) has the molecular formula C19H17F3N6O2 and a molecular weight of 418.38 g/mol. Its IUPAC name is 6-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136761500 |
| Molecular Formula | C19H17F3N6O2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 6-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(C(=O)c1cc3nc(C4CC4)cc(C(F)(F)F)n3n1)CC2 |
| InChI | InChI=1S/C19H17F3N6O2/c1-9-23-12-4-5-27(8-11(12)17(29)24-9)18(30)14-7-16-25-13(10-2-3-10)6-15(19(20,21)22)28(16)26-14/h6-7,10H,2-5,8H2,1H3,(H,23,24,29) |
| InChIKey | DPVNRTOSESLPGD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |