About 6-fluoro-1,2-benzoxazol-4-ol
6-fluoro-1,2-benzoxazol-4-ol (PubChem CID 136762347) has the molecular formula C7H4FNO2
and a molecular weight of 153.11 g/mol. Its IUPAC name is 6-fluoro-1,2-benzoxazol-4-ol.
Molecular Properties
| Compound Name | 6-fluoro-1,2-benzoxazol-4-ol |
| PubChem CID | 136762347 |
| Molecular Formula | C7H4FNO2 |
| Molecular Weight | 153.11 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 6-fluoro-1,2-benzoxazol-4-ol |
| SMILES | Oc1cc(F)cc2oncc12 |
| InChI | InChI=1S/C7H4FNO2/c8-4-1-6(10)5-3-9-11-7(5)2-4/h1-3,10H |
| InChIKey | RECARGMXDFPXGM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.11 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-1,2-benzoxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,2-benzoxazol-4-ol?
The IUPAC name of 6-fluoro-1,2-benzoxazol-4-ol (CID 136762347) is 6-fluoro-1,2-benzoxazol-4-ol.
What is the SMILES notation for 6-fluoro-1,2-benzoxazol-4-ol?
The canonical SMILES for 6-fluoro-1,2-benzoxazol-4-ol is Oc1cc(F)cc2oncc12.
What is the InChIKey of 6-fluoro-1,2-benzoxazol-4-ol?
The InChIKey is RECARGMXDFPXGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO2/c8-4-1-6(10)5-3-9-11-7(5)2-4/h1-3,10H.
What are the key properties of 6-fluoro-1,2-benzoxazol-4-ol?
6-fluoro-1,2-benzoxazol-4-ol has a molecular weight of 153.11 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,2-benzoxazol-4-ol is sourced from PubChem (CID 136762347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).