C11H18IN3OS — CID 136762588
4-[(2-ethyl-2-methylsulfanylbutyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136762588) has the molecular formula C11H18IN3OS and a molecular weight of 367.26 g/mol. Its IUPAC name is 4-[(2-ethyl-2-methylsulfanylbutyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-ethyl-2-methylsulfanylbutyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136762588 |
| Molecular Formula | C11H18IN3OS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-[(2-ethyl-2-methylsulfanylbutyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC(CC)(CNc1nc[nH]c(=O)c1I)SC |
| InChI | InChI=1S/C11H18IN3OS/c1-4-11(5-2,17-3)6-13-9-8(12)10(16)15-7-14-9/h7H,4-6H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | ABQKZMKQEPSSRY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|