C11H16BrN3OS — CID 136762608
5-bromo-4-[(1-methylsulfanylcyclopentyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136762608) has the molecular formula C11H16BrN3OS and a molecular weight of 318.24 g/mol. Its IUPAC name is 5-bromo-4-[(1-methylsulfanylcyclopentyl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(1-methylsulfanylcyclopentyl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136762608 |
| Molecular Formula | C11H16BrN3OS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 5-bromo-4-[(1-methylsulfanylcyclopentyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | CSC1(CNc2nc[nH]c(=O)c2Br)CCCC1 |
| InChI | InChI=1S/C11H16BrN3OS/c1-17-11(4-2-3-5-11)6-13-9-8(12)10(16)15-7-14-9/h7H,2-6H2,1H3,(H2,13,14,15,16) |
| InChIKey | XUCUHTDJZDJMIM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |