C12H14N2O6 — CID 136763071
(2S,4E)-4-[2-[(1S)-1-carboxyethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 136763071) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2S,4E)-4-[2-[(1S)-1-carboxyethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | (2S,4E)-4-[2-[(1S)-1-carboxyethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 136763071 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2S,4E)-4-[2-[(1S)-1-carboxyethyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | C[C@H](/N=C/C=C1/C=C(C(=O)O)N[C@H](C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C12H14N2O6/c1-6(10(15)16)13-3-2-7-4-8(11(17)18)14-9(5-7)12(19)20/h2-4,6,9,14H,5H2,1H3,(H,15,16)(H,17,18)(H,19,20)/b7-2-,13-3+/t6-,9-/m0/s1 |
| InChIKey | XZPOAQOHKACLJQ-YXQQZSMXSA-N |
| XLogP | -0.13 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|